.png | CAS_number = 723-46-6 |ATC_prefix = J01 |ATC_suffix = EC01 |PubChem = 5329 | DrugBank = APRD00076 | C = 10 |H = 11 |N = 3 |O = 3 |S = 1 | molecular_weight = 253.279 g/mol | smiles = CC1=CC(=NO1)NS(=O)(=O)C2=CC=C(C=C2)N | melting_point = 3 | protein_bound = 70% | metabolism = Hepatic acetylation and glucuronidation | elimination_half-life = 10 hours | excretion = Renal | pregnancy_category = C (Au, U.S.)| legal_status = ℞-only (U.S., Ca)| routes_of_administration = Oral}} Sulfamethoxazole is a sulfonamide antibiotic. It is most often used as part of a synergistic combination with trimethoprim in a 5:1 ratio in co-trimoxazole, which is also known as Bactrim or Septrim. It can be used an alternative of amoxicillin-based antibiotics to treat sinusitis.
Antibiotics :: Drugs and Medications

Sulfamethoxazole - Familydoctor.org - Information for patients in English and Spanish.
| Drugs in Drinking Water Mind Control Must Watch! | |
| Next Video | |